Data structures are the backbone of problem-solving and acing programming interviews. If you're new to the world of computer science, don't worry! Understanding data structures might seem daunting at first, but with a little guidance, it can be simplified for beginners like you.
Before we dive into the nitty-gritty of data structures, let's understand the importance of choosing the right one. Each data structure has its strengths and weaknesses, and selecting the appropriate one can significantly impact the performance of your code. We often use Big O notation to measure their efficiency.
One of the fundamental data structures is the linked list, which consists of nodes with values and pointers. Linked lists are great for adding and deleting nodes but can be a bit slow when it comes to retrieving or searching elements.
To build a solid foundation in data structures, focus on three key ones: arrays, linked lists, and hash tables.
Arrays are fixed in size, making adding elements inefficient at times. However, they excel at retrieving items quickly by computing the item's location inside the array.
Linked lists are perfect for scenarios where you need to add or remove elements efficiently. However, accessing elements might be a bit slower compared to arrays.
Hash tables, on the other hand, allow for efficient retrieval of values based on keys. They use a hashing function to determine the memory location, making them incredibly fast for data retrieval.
While hash tables are powerful, they can suffer from collisions, where two keys hash to the same memory location. But fear not! There are various methods to resolve these collisions and ensure your hash table works flawlessly.
Data structures and algorithms are the heart and soul of computer science. For instance, the depth-first search is a vital algorithm that's used extensively. Additionally, queues and stacks are efficient data structures employed in breadth-first search and other limited use cases.
Graphs and trees also play a crucial role in computer science. They share similarities with linked lists, where nodes point to other nodes, creating a complex but organized network.
When it comes to searching efficiently, Binary Search Trees (BSTs) take the crown. With specific rules governing node relationships, traversing a BST allows for quick element location, making it a popular choice in various applications.
As a beginner, you might wonder how to enhance your skills in data structures and algorithms. Firstly, practice is key! Code Wars and Leet Code are fantastic platforms for honing your problem-solving abilities. Leet Code, in particular, features programming interview questions from tech companies, giving you real-world challenges to tackle.
Now that we got the base essentials out of the way. we can look further into the horizon and take a gander at some of the most important Algos there are. The main goal of an algorithm is to take in input, process it and provide an output that is expected. Algorithms can be classified based on the time and space complexity, the technique used for solving the problem, and the type of problem it solves. Examples of algorithms are sorting, searching, graph traversals, string manipulations, mathematical operations, and many more.
These algorithms are widely used in various applications and it’s important for a programmer to have a strong understanding of them. So I will try my best to explain them.

function quicksort(arr) {
if (arr.length <= 1) {
return arr;
}
const pivot = arr[Math.floor(arr.length / 2)];
const left = [];
const middle = [];
const right = [];
for (let i = 0; i < arr.length; i++) {
if (arr[i] < pivot) {
left.push(arr[i]);
} else if (arr[i] === pivot) {
middle.push(arr[i]);
} else {
right.push(arr[i]);
}
}
return quicksort(left).concat(middle).concat(quicksort(right));
}
console.log(quicksort([3, 6, 8, 10, 1, 2, 1]));

function merge_sort(arr) {
if (arr.length <= 1) {
return arr;
}
const mid = Math.floor(arr.length / 2);
const left = merge_sort(arr.slice(0, mid));
const right = merge_sort(arr.slice(mid));
return merge(left, right);
}
function merge(left, right) {
const result = [];
let i = 0;
let j = 0;
while (i < left.length && j < right.length) {
if (left[i] < right[j]) {
result.push(left[i]);
i++;
} else {
result.push(right[j]);
j++;
}
}
return result.concat(left.slice(i)).concat(right.slice(j));
}
console.log(merge_sort([3, 6, 8, 10, 1, 2, 1]));

function heap_sort(arr) {
const n = arr.length;
for (let i = Math.floor(n / 2) - 1; i >= 0; i--) {
heapify(arr, n, i);
}
for (let i = n - 1; i > 0; i--) {
[arr[i], arr[0]] = [arr[0], arr[i]];
heapify(arr, i, 0);
}
}
function heapify(arr, n, i) {
let largest = i;
let left = 2 *i + 1;
let right = 2* i + 2;
if (left < n && arr[left] > arr[largest]) {
largest = left;
}
if (right < n && arr[right] > arr[largest]) {
largest = right;
}
if (largest !== i) {
[arr[i], arr[largest]] = [arr[largest], arr[i]];
heapify(arr, n, largest);
}
}
const arr = [3, 6, 8, 10, 1, 2, 1];
heap_sort(arr);
console.log(arr);

function binarySearch(arr, target) {
let left = 0;
let right = arr.length - 1;
while (left <= right) {
const mid = Math.floor((left + right) / 2);
if (arr[mid] === target) {
return mid; // Found the target, return its index
} else if (arr[mid] < target) {
left = mid + 1; // Target is in the right half of the current range
} else {
right = mid - 1; // Target is in the left half of the current range
}
}
return -1; // Target not found in the array
}
// Example usage:
const sortedArray = [1, 3, 5, 7, 9, 11, 13, 15, 17];
const targetValue = 9;
const resultIndex = binarySearch(sortedArray, targetValue);
if (resultIndex !== -1) {
console.log(`Target ${targetValue} found at index ${resultIndex}.`);
} else {
console.log(`Target ${targetValue} not found in the array.`);
}
In this implementation, the binarySearch function takes a sorted array (arr) and a target value (target) as inputs. It sets two pointers, left and right, initially pointing to the first and last elements of the array, respectively.
It then enters a loop that continues as long as left is less than or equal to right. In each iteration, it calculates the middle index (mid) of the current range. If the element at the middle index is equal to the target value, the function returns the index. If the target value is less than the element at mid, it updates right to search in the left half of the current range; otherwise, it updates left to search in the right half.
If the loop exits without finding the target value, the function returns -1 to indicate that the target value is not present in the array.
The example usage demonstrates searching for the target value 9 in the sorted array. If the target value is found, it prints the index where it was found; otherwise, it indicates that the target value is not present in the array.

class HashTable {
constructor() {
this.size = 10;
this.keys = new Array(this.size);
this.values = new Array(this.size);
}
put(key, data) {
const index = this.hashFunction(key);
while (this.keys[index] !== undefined) {
if (this.keys[index] === key) {
this.values[index] = data; // update
return;
}
index = (index + 1) % this.size;
}
this.keys[index] = key;
this.values[index] = data;
}
get(key) {
const index = this.hashFunction(key);
while (this.keys[index] !== undefined) {
if (this.keys[index] === key) {
return this.values[index];
}
index = (index + 1) % this.size;
}
return undefined;
}
hashFunction(key) {
let sum = 0;
for (let pos = 0; pos < key.length; pos++) {
sum += key.charCodeAt(pos);
}
return sum % this.size;
}
}
const t = new HashTable();
t.put("apple", 10);
t.put("orange", 20);
t.put("banana", 30);
console.log(t.get("orange"));

const PriorityQueue = require("priorityqueuejs");
function dijkstra(graph, start) {
const heap = new PriorityQueue((a, b) => a[0] - b[0]);
const visited = new Set();
heap.enq([0, start]);
while (!heap.isEmpty()) {
const [cost, v] = heap.deq();
if (!visited.has(v)) {
visited.add(v);
for (let u in graph[v]) {
if (!visited.has(u)) {
heap.enq([cost + graph[v][u], u]);
}
}
}
}
return visited;
}
const graph = {
A: { B: 2, C: 3 },
B: { D: 4, E: 5 },
C: { F: 6 },
D: { G: 7 },
E: { G: 8, H: 9 },
F: { H: 10 },
G: {},
H: {},
};
console.log(dijkstra(graph, "A"));

function fibonacci(n) {
if (n <= 0) {
return 0;
} else if (n === 1) {
return 1;
} else {
return fibonacci(n - 1) + fibonacci(n - 2);
}
}
console.log(fibonacci(10));
To create a greedy algorithm, you need to follow the principle of choosing the optimal choice at each moment in time. For example, when counting change, you start with the highest denomination and work backward to select the coins that fit the change amount.
Here's a brief summary of the key points for this algo:
Remember that the runtime of a greedy algorithm is often dominated by the loops involved, making it O(n^2) in some cases. In situations where greedy algorithms fail to find the globally optimal solution, alternatives like Dynamic Programming may be necessary.

Definition of Greedy Algorithms: Greedy algorithms are a class of algorithms that make locally optimal choices at each step with the hope of finding the globally optimal solution. They follow the principle of immediate gratification, focusing on what seems best at the current moment without considering the consequences of those choices on future steps.
The Greedy Property: The central idea behind greedy algorithms is the greedy property, which is defined as choosing the best option at that exact moment in time. This property guides the algorithm in making decisions, always selecting the most favorable choice available without foresight.
Speed and Efficiency: Greedy algorithms are known for their speed and efficiency. They often outperform alternative approaches like Divide & Conquer and Dynamic Programming, especially in scenarios where the globally optimal solution can be approximated effectively using local decisions.
Applications: Greedy algorithms find applications in various fields, including computer science, mathematics, and engineering. Some well-known algorithms that employ the greedy approach include:
Designing Greedy Algorithms: Creating a greedy algorithm involves defining the problem in such a way that you can identify the optimal choice at each step. This typically requires formulating the problem with specific constraints and objectives.
Example: Counting Change: An illustrative example of a greedy algorithm is counting change. The algorithm starts with the highest denomination and works backward, selecting coins that fit the change amount until it can no longer use a particular coin. This approach often works well in practice, as it approximates the optimal solution effectively for everyday scenarios.
Optimality of Greedy Algorithms: While greedy algorithms excel in many cases, they are not always guaranteed to find the globally optimal solution. The article highlights an example where a greedy change-making algorithm fails to identify the best solution. In such cases, alternatives like Dynamic Programming or brute-force approaches may be required.
Complexity: The runtime complexity of a greedy algorithm often depends on the loops involved in the decision-making process. In some cases, it can be O(n^2) or worse. It's essential to analyze the specific algorithm and problem to determine its efficiency.
Trade-offs: Greedy algorithms trade off computational efficiency for the possibility of suboptimal solutions. They are suitable for problems where approximation is acceptable and speed is critical, but they may not be suitable for problems where finding the globally optimal solution is essential.
In summary, greedy algorithms are a powerful class of algorithms that make decisions based on local optimization, and they find use in a wide range of applications. While they are fast and efficient, it's crucial to be aware of their limitations and when they might not provide the best solution. In such cases, alternative algorithmic approaches should be considered.

A* can be considered a kind of greedy algorithm, but it's a "smart" or "informed" greedy algorithm. It's a bit more sophisticated than traditional greedy algorithms because it combines greedy principles with information from a heuristic function.
In a traditional greedy algorithm, you always choose the locally optimal choice at each step without considering the bigger picture. A* is "greedy" in the sense that it focuses on the most promising path based on the heuristic estimate. It selects the next node to explore based on the sum of the cost to reach that node from the start and the estimated cost to reach the goal from that node.
So, while A* makes locally optimal choices, it uses heuristics to make those choices smarter and more informed. It's designed to efficiently find the optimal path by prioritizing nodes that are likely to lead to the goal.
In summary, A* is a kind of "greedy" algorithm, but it's enhanced by heuristics to make more intelligent decisions, which often leads to finding the optimal path more efficiently.
class Node {
constructor(x, y) {
this.x = x;
this.y = y;
this.g = 0; // Cost from start node to this node
this.h = 0; // Heuristic (estimated cost from this node to the goal)
this.f = 0; // Total cost (f = g + h)
this.parent = null; // Parent node for tracing the path
}
}
function astar(grid, start, end) {
const openSet = [];
const closedSet = [];
openSet.push(start);
while (openSet.length > 0) {
let current = openSet[0];
let currentIndex = 0;
// Find the node with the lowest f value in the openSet
openSet.forEach((node, index) => {
if (node.f < current.f) {
current = node;
currentIndex = index;
}
});
// Remove the current node from the openSet
openSet.splice(currentIndex, 1);
// Add the current node to the closedSet
closedSet.push(current);
// If we reached the end, reconstruct the path and return it
if (current === end) {
const path = [];
let temp = current;
while (temp) {
path.push([temp.x, temp.y]);
temp = temp.parent;
}
return path.reverse();
}
const neighbors = [];
const { x, y } = current;
// Define the possible neighboring nodes (adjust for your grid structure)
if (grid[x - 1] && grid[x - 1][y]) neighbors.push(grid[x - 1][y]);
if (grid[x + 1] && grid[x + 1][y]) neighbors.push(grid[x + 1][y]);
if (grid[x][y - 1]) neighbors.push(grid[x][y - 1]);
if (grid[x][y + 1]) neighbors.push(grid[x][y + 1]);
neighbors.forEach((neighbor) => {
if (!closedSet.includes(neighbor)) {
const tempG = current.g + 1; // Assuming that the cost to move to a neighboring node is 1
if (!openSet.includes(neighbor) || tempG < neighbor.g) {
neighbor.g = tempG;
neighbor.h = heuristic(neighbor, end); // You need to define the heuristic function
neighbor.f = neighbor.g + neighbor.h;
neighbor.parent = current;
if (!openSet.includes(neighbor)) openSet.push(neighbor);
}
}
});
}
// If no path is found
return null;
}
function heuristic(nodeA, nodeB) {
// You need to define your heuristic function here (e.g., Manhattan distance)
return Math.abs(nodeA.x - nodeB.x) + Math.abs(nodeA.y - nodeB.y);
}
// Example usage:
const gridSizeX = 5;
const gridSizeY = 5;
const grid = new Array(gridSizeX);
for (let i = 0; i < gridSizeX; i++) {
grid[i] = new Array(gridSizeY);
for (let j = 0; j < gridSizeY; j++) {
grid[i][j] = new Node(i, j);
}
}
const startNode = grid[0][0];
const endNode = grid[4][4];
const path = astar(grid, startNode, endNode);
if (path) {
console.log("Path found:", path);
} else {
console.log("No path found.");
}

var solveNQueens = function (n) {
var res = [];
if (n === 1 || n >= 4) dfs(res, [], n, 0);
return res;
};
var dfs = function (res, points, n, index) {
for (var i = index; i < n; i++) {
if (points.length !== i) return;
for (var j = 0; j < n; j++) {
if (isValid(points, [i, j])) {
points.push([i, j]);
dfs(res, points, n, i + 1);
if (points.length === n) res.push(buildRes(points));
points.pop();
}
}
}
};
var buildRes = function (points) {
var res = [];
var n = points.length;
for (var i = 0; i < n; i++) {
res[i] = "";
for (var j = 0; j < n; j++) {
res[i] += points[i][1] === j ? "Q" : ".";
}
}
return res;
};
var isValid = function (oldPoints, newPoint) {
var len = oldPoints.length;
for (var i = 0; i < len; i++) {
if (oldPoints[i][0] === newPoint[0] || oldPoints[i][1] === newPoint[1])
return false;
if (
Math.abs(
(oldPoints[i][0] - newPoint[0]) / (oldPoints[i][1] - newPoint[1])
) === 1
)
return false;
}
return true;
};
The main function, solveNQueens, initializes an empty res array and calls the dfs function to perform the depth-first search. After the search is complete, the function returns the res array.
The dfs function takes a res array, a points array to store the positions of the queens, the board size n, and an index parameter indicating the row being considered. It iterates over the columns in the current row and checks if placing a queen at that position is valid according to the isValid function.
The isValid function determines whether placing a queen at the new point is valid by checking for conflicts with the queens already placed. It iterates through the oldPoints array, which contains the coordinates of previously placed queens, and checks for conflicts in row, column, and diagonal positions.
The buildRes function constructs a valid solution representation from the points array, where 'Q' represents a queen and '.' represents an empty position on the board.
Considering the dfs function, the worst-case time complexity occurs when all possible configurations need to be explored. This happens when the first if condition in the dfs function is met (points.length !== i), which causes the function to return early. In this case, the time complexity is proportional to the number of valid solutions.
For each row, the number of valid positions decreases, which reduces the branching factor. Therefore, the time complexity is not as high as O(N!), but it is still exponential. The exact time complexity of this implementation is difficult to determine precisely due to the varying number of valid positions at each row. In practice, it performs better than the straightforward backtracking solution but can still be slow for large values of N.

function randomInt(min, max) {
return Math.floor(Math.random() * (max - min + 1)) + min;
}
function swap(arr, i, j) {
const temp = arr[i];
arr[i] = arr[j];
arr[j] = temp;
}
function partition(arr, low, high) {
const pivotIndex = randomInt(low, high);
const pivotValue = arr[pivotIndex];
swap(arr, pivotIndex, high);
let partitionIndex = low;
for (let i = low; i < high; i++) {
if (arr[i] < pivotValue) {
swap(arr, i, partitionIndex);
partitionIndex++;
}
}
swap(arr, partitionIndex, high);
return partitionIndex;
}
function quickSort(arr, low, high) {
if (low < high) {
const pivotIndex = partition(arr, low, high);
quickSort(arr, low, pivotIndex - 1);
quickSort(arr, pivotIndex + 1, high);
}
}
// Example usage:
const arrayToSort = [9, 3, 7, 1, 5, 6, 8, 2, 4];
console.log("Original array:", arrayToSort);
quickSort(arrayToSort, 0, arrayToSort.length - 1);
console.log("Sorted array:", arrayToSort);
In this implementation, randomInt is a helper function that generates a random integer between min and max, inclusive. The swap function is used to swap elements in the array. The partition function picks a random pivot element, places it at the end of the array, and rearranges the array so that all elements less than the pivot are on the left side, and all elements greater than or equal to the pivot are on the right side.
The quickSort function recursively calls itself on the left and right subarrays until the entire array is sorted.
Keep in mind that this implementation modifies the original array in place. If you want to keep the original array unchanged, you can make a copy of it and sort the copy instead.
These are some of the most commonly used algorithms that every programmer should be familiar with. Understanding these algorithms and their implementation can help a programmer to make better decisions when it comes to designing and implementing efficient solutions.
Data structures are the building blocks of efficient algorithms and problem-solving in computer science. While they might appear complex initially, with practice and the right guidance, you'll soon find yourself embracing their power and using them to create elegant and efficient solutions.
So, why wait? Start your data structure journey today and unlock the true potential of your coding skills. Remember, it's not just about mastering algorithms; it's about becoming a better problem solver and a skilled software engineer. Happy coding!
Sites used for visualizations: